C23H34O4 — CID 136898395
[(S)-[(8R,9S,10S,13S,14S,17S)-17-acetyloxy-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]-deuteriomethyl] acetate (PubChem CID 136898395) has the molecular formula C23H34O4 and a molecular weight of 376.53 g/mol. Its IUPAC name is [(S)-[(8R,9S,10S,13S,14S,17S)-17-acetyloxy-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]-deuteriomethyl] acetate.
| Compound Name | [(S)-[(8R,9S,10S,13S,14S,17S)-17-acetyloxy-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]-deuteriomethyl] acetate |
|---|---|
| PubChem CID | 136898395 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [(S)-[(8R,9S,10S,13S,14S,17S)-17-acetyloxy-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]-deuteriomethyl] acetate |
| SMILES | [2H][C@H](OC(C)=O)[C@]12CCCCC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2([2H])OC(C)=O |
| InChI | InChI=1S/C23H34O4/c1-15(24)26-14-23-12-5-4-6-17(23)7-8-18-19-9-10-21(27-16(2)25)22(19,3)13-11-20(18)23/h7,18-21H,4-6,8-14H2,1-3H3/t18-,19-,20-,21-,22-,23+/m0/s1/i14D,21D/t14-,18-,19-,20-,21-,22-,23+ |
| InChIKey | TVPCVKRZWKHBKO-AMCWPAOZSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|