C25H36O6 — CID 25240054
[(3S,8R,9S,10S,13S,14S,17S)-17-acetyloxy-10-[(R)-acetyloxy(deuterio)methyl]-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 25240054) has the molecular formula C25H36O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13S,14S,17S)-17-acetyloxy-10-[(R)-acetyloxy(deuterio)methyl]-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10S,13S,14S,17S)-17-acetyloxy-10-[(R)-acetyloxy(deuterio)methyl]-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 25240054 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | [(3S,8R,9S,10S,13S,14S,17S)-17-acetyloxy-10-[(R)-acetyloxy(deuterio)methyl]-17-deuterio-13-methyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | [2H][C@@H](OC(C)=O)[C@]12CC[C@H](OC(C)=O)CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2([2H])OC(C)=O |
| InChI | InChI=1S/C25H36O6/c1-15(26)29-14-25-12-9-19(30-16(2)27)13-18(25)5-6-20-21-7-8-23(31-17(3)28)24(21,4)11-10-22(20)25/h5,19-23H,6-14H2,1-4H3/t19-,20-,21-,22-,23-,24-,25+/m0/s1/i14D,23D/t14-,19+,20+,21+,22+,23+,24+,25-/m1 |
| InChIKey | VYZKDFDGOYBYSU-FKAYZOHQSA-N |
| XLogP | 4.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|