C15H13FN2O2 — CID 136903729
2-(1-ethyl-5-fluorobenzimidazol-2-yl)benzene-1,4-diol (PubChem CID 136903729) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-(1-ethyl-5-fluorobenzimidazol-2-yl)benzene-1,4-diol.
| Compound Name | 2-(1-ethyl-5-fluorobenzimidazol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136903729 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(1-ethyl-5-fluorobenzimidazol-2-yl)benzene-1,4-diol |
| SMILES | CCn1c(-c2cc(O)ccc2O)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H13FN2O2/c1-2-18-13-5-3-9(16)7-12(13)17-15(18)11-8-10(19)4-6-14(11)20/h3-8,19-20H,2H2,1H3 |
| InChIKey | NPKHOFALXOQERC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|