C16H15FN2O2 — CID 136903734
4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)benzene-1,3-diol (PubChem CID 136903734) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)benzene-1,3-diol.
| Compound Name | 4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136903734 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)benzene-1,3-diol |
| SMILES | CC(C)n1c(-c2ccc(O)cc2O)nc2cc(F)ccc21 |
| InChI | InChI=1S/C16H15FN2O2/c1-9(2)19-14-6-3-10(17)7-13(14)18-16(19)12-5-4-11(20)8-15(12)21/h3-9,20-21H,1-2H3 |
| InChIKey | VIUGMKJSQOWASS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |