C16H13FN2O2 — CID 136903801
2-(1-cyclopropyl-6-fluorobenzimidazol-2-yl)benzene-1,4-diol (PubChem CID 136903801) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-(1-cyclopropyl-6-fluorobenzimidazol-2-yl)benzene-1,4-diol.
| Compound Name | 2-(1-cyclopropyl-6-fluorobenzimidazol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136903801 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(1-cyclopropyl-6-fluorobenzimidazol-2-yl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2nc3ccc(F)cc3n2C2CC2)c1 |
| InChI | InChI=1S/C16H13FN2O2/c17-9-1-5-13-14(7-9)19(10-2-3-10)16(18-13)12-8-11(20)4-6-15(12)21/h1,4-8,10,20-21H,2-3H2 |
| InChIKey | JTBIQHPNZKHRCW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|