C13H11N3O2 — CID 136903815
2-(1-methylimidazo[4,5-c]pyridin-2-yl)benzene-1,4-diol (PubChem CID 136903815) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-(1-methylimidazo[4,5-c]pyridin-2-yl)benzene-1,4-diol.
| Compound Name | 2-(1-methylimidazo[4,5-c]pyridin-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136903815 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(1-methylimidazo[4,5-c]pyridin-2-yl)benzene-1,4-diol |
| SMILES | Cn1c(-c2cc(O)ccc2O)nc2cnccc21 |
| InChI | InChI=1S/C13H11N3O2/c1-16-11-4-5-14-7-10(11)15-13(16)9-6-8(17)2-3-12(9)18/h2-7,17-18H,1H3 |
| InChIKey | WIVPRXLDPMZEJB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|