C14H17N3O4 — CID 136904167
2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol (PubChem CID 136904167) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol.
| Compound Name | 2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136904167 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[3-(4-ethylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol |
| SMILES | CCN1CCOC(c2noc(-c3cc(O)ccc3O)n2)C1 |
| InChI | InChI=1S/C14H17N3O4/c1-2-17-5-6-20-12(8-17)13-15-14(21-16-13)10-7-9(18)3-4-11(10)19/h3-4,7,12,18-19H,2,5-6,8H2,1H3 |
| InChIKey | DVLKTOVXIIPYPJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|