C12H9N3O5 — CID 136904575
3-[(3,4-dihydroxybenzoyl)amino]pyrazine-2-carboxylic acid (PubChem CID 136904575) has the molecular formula C12H9N3O5 and a molecular weight of 275.22 g/mol. Its IUPAC name is 3-[(3,4-dihydroxybenzoyl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 3-[(3,4-dihydroxybenzoyl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 136904575 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-[(3,4-dihydroxybenzoyl)amino]pyrazine-2-carboxylic acid |
| SMILES | O=C(Nc1nccnc1C(=O)O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H9N3O5/c16-7-2-1-6(5-8(7)17)11(18)15-10-9(12(19)20)13-3-4-14-10/h1-5,16-17H,(H,19,20)(H,14,15,18) |
| InChIKey | ZPEJWQDZUOHVHX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|