C12H6F3N3O3 — CID 63262348
3-[(3,4,5-trifluorobenzoyl)amino]pyrazine-2-carboxylic acid (PubChem CID 63262348) has the molecular formula C12H6F3N3O3 and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-[(3,4,5-trifluorobenzoyl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 3-[(3,4,5-trifluorobenzoyl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 63262348 |
| Molecular Formula | C12H6F3N3O3 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3-[(3,4,5-trifluorobenzoyl)amino]pyrazine-2-carboxylic acid |
| SMILES | O=C(Nc1nccnc1C(=O)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H6F3N3O3/c13-6-3-5(4-7(14)8(6)15)11(19)18-10-9(12(20)21)16-1-2-17-10/h1-4H,(H,20,21)(H,17,18,19) |
| InChIKey | QWUCZJJXAOHEKM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|