C18H14BrIN4 — CID 136904880
(7R)-7-(4-bromophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136904880) has the molecular formula C18H14BrIN4 and a molecular weight of 493.15 g/mol. Its IUPAC name is (7R)-7-(4-bromophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (7R)-7-(4-bromophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136904880 |
| Molecular Formula | C18H14BrIN4 |
| Molecular Weight | 493.15 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | (7R)-7-(4-bromophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1nc2n(n1)[C@@H](c1ccc(Br)cc1)C=C(c1ccc(I)cc1)N2 |
| InChI | InChI=1S/C18H14BrIN4/c1-11-21-18-22-16(12-4-8-15(20)9-5-12)10-17(24(18)23-11)13-2-6-14(19)7-3-13/h2-10,17H,1H3,(H,21,22,23)/t17-/m1/s1 |
| InChIKey | TZKDADMXNGNNPQ-QGZVFWFLSA-N |
| XLogP | 5.01 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.15 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|