C18H14ClIN4 — CID 4086047
7-(2-chlorophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 4086047) has the molecular formula C18H14ClIN4 and a molecular weight of 448.70 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(2-chlorophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 4086047 |
| Molecular Formula | C18H14ClIN4 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 7-(2-chlorophenyl)-5-(4-iodophenyl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1nc2n(n1)C(c1ccccc1Cl)C=C(c1ccc(I)cc1)N2 |
| InChI | InChI=1S/C18H14ClIN4/c1-11-21-18-22-16(12-6-8-13(20)9-7-12)10-17(24(18)23-11)14-4-2-3-5-15(14)19/h2-10,17H,1H3,(H,21,22,23) |
| InChIKey | JJPVKLOYBZUDFZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|