C19H13N5O6S — CID 136905035
2-[(2Z,5R)-2-(1,3-dioxoisoindol-2-yl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 136905035) has the molecular formula C19H13N5O6S and a molecular weight of 439.41 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-(1,3-dioxoisoindol-2-yl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(2Z,5R)-2-(1,3-dioxoisoindol-2-yl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 136905035 |
| Molecular Formula | C19H13N5O6S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-[(2Z,5R)-2-(1,3-dioxoisoindol-2-yl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\N2C(=O)c3ccccc3C2=O)NC1=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13N5O6S/c25-15(20-12-7-3-4-8-13(12)24(29)30)9-14-16(26)21-19(31-14)22-23-17(27)10-5-1-2-6-11(10)18(23)28/h1-8,14H,9H2,(H,20,25)(H,21,22,26)/t14-/m1/s1 |
| InChIKey | POHAJHWOMPUEBF-CQSZACIVSA-N |
| XLogP | 1.72 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|