C18H17N3O5S — CID 7454627
2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 7454627) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7454627 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | CCOc1ccc2c(c1)S[C@H](CC(=O)Nc1ccccc1[N+](=O)[O-])C(=O)N2 |
| InChI | InChI=1S/C18H17N3O5S/c1-2-26-11-7-8-13-15(9-11)27-16(18(23)20-13)10-17(22)19-12-5-3-4-6-14(12)21(24)25/h3-9,16H,2,10H2,1H3,(H,19,22)(H,20,23)/t16-/m1/s1 |
| InChIKey | XFFAQIDOTSXFIM-MRXNPFEDSA-N |
| XLogP | 3.44 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|