C15H18N2O3S — CID 7456367
2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-prop-2-enylacetamide (PubChem CID 7456367) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 7456367 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[(2R)-7-ethoxy-3-oxo-4H-1,4-benzothiazin-2-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C[C@H]1Sc2cc(OCC)ccc2NC1=O |
| InChI | InChI=1S/C15H18N2O3S/c1-3-7-16-14(18)9-13-15(19)17-11-6-5-10(20-4-2)8-12(11)21-13/h3,5-6,8,13H,1,4,7,9H2,2H3,(H,16,18)(H,17,19)/t13-/m1/s1 |
| InChIKey | BXYNYVCJCZDHDL-CYBMUJFWSA-N |
| XLogP | 2.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|