C20H22N4O5 — CID 7112179
2-[(2S)-6,7-dimethyl-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]-N-(4-ethoxy-2-nitrophenyl)acetamide (PubChem CID 7112179) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(2S)-6,7-dimethyl-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]-N-(4-ethoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(2S)-6,7-dimethyl-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]-N-(4-ethoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7112179 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[(2S)-6,7-dimethyl-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]-N-(4-ethoxy-2-nitrophenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)C[C@@H]2Nc3cc(C)c(C)cc3NC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N4O5/c1-4-29-13-5-6-14(18(9-13)24(27)28)22-19(25)10-17-20(26)23-16-8-12(3)11(2)7-15(16)21-17/h5-9,17,21H,4,10H2,1-3H3,(H,22,25)(H,23,26)/t17-/m0/s1 |
| InChIKey | HUCRAAIIVOHMPA-KRWDZBQOSA-N |
| XLogP | 3.37 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|