C17H17N5O3S — CID 136905063
ethyl 4-amino-2-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 136905063) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is ethyl 4-amino-2-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 136905063 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | ethyl 4-amino-2-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(S[C@@H](C)c2nc3ccccc3c(=O)[nH]2)nc1N |
| InChI | InChI=1S/C17H17N5O3S/c1-3-25-16(24)11-8-19-17(21-13(11)18)26-9(2)14-20-12-7-5-4-6-10(12)15(23)22-14/h4-9H,3H2,1-2H3,(H2,18,19,21)(H,20,22,23)/t9-/m0/s1 |
| InChIKey | CGTJHTSXSNMJNE-VIFPVBQESA-N |
| XLogP | 2.33 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |