C18H27N5 — CID 136905334
(1S)-N,N-dimethyl-1-(4-methylphenyl)-N'-[[(6R)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine (PubChem CID 136905334) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-(4-methylphenyl)-N'-[[(6R)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine.
| Compound Name | (1S)-N,N-dimethyl-1-(4-methylphenyl)-N'-[[(6R)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 136905334 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (1S)-N,N-dimethyl-1-(4-methylphenyl)-N'-[[(6R)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine |
| SMILES | Cc1ccc([C@@H](CNC[C@@H]2CNc3ccnn3C2)N(C)C)cc1 |
| InChI | InChI=1S/C18H27N5/c1-14-4-6-16(7-5-14)17(22(2)3)12-19-10-15-11-20-18-8-9-21-23(18)13-15/h4-9,15,17,19-20H,10-13H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | REPRLXGMSDSSGS-NVXWUHKLSA-N |
| XLogP | 2.13 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |