C18H26FN5 — CID 136905360
(1S)-1-(3-fluorophenyl)-N,N-dimethyl-N'-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine (PubChem CID 136905360) has the molecular formula C18H26FN5 and a molecular weight of 331.44 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)-N,N-dimethyl-N'-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine.
| Compound Name | (1S)-1-(3-fluorophenyl)-N,N-dimethyl-N'-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 136905360 |
| Molecular Formula | C18H26FN5 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)-N,N-dimethyl-N'-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]ethane-1,2-diamine |
| SMILES | Cc1cc2n(n1)C[C@H](CNC[C@H](c1cccc(F)c1)N(C)C)CN2 |
| InChI | InChI=1S/C18H26FN5/c1-13-7-18-21-10-14(12-24(18)22-13)9-20-11-17(23(2)3)15-5-4-6-16(19)8-15/h4-8,14,17,20-21H,9-12H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | KBMBFADJODPWFJ-RHSMWYFYSA-N |
| XLogP | 2.26 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |