C14H25N5O — CID 136905592
N-[(2S)-butan-2-yl]-3-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methylamino]propanamide (PubChem CID 136905592) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-3-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methylamino]propanamide.
| Compound Name | N-[(2S)-butan-2-yl]-3-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 136905592 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | N-[(2S)-butan-2-yl]-3-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methylamino]propanamide |
| SMILES | CC[C@H](C)NC(=O)CCNC[C@H]1CNc2ccnn2C1 |
| InChI | InChI=1S/C14H25N5O/c1-3-11(2)18-14(20)5-6-15-8-12-9-16-13-4-7-17-19(13)10-12/h4,7,11-12,15-16H,3,5-6,8-10H2,1-2H3,(H,18,20)/t11-,12-/m0/s1 |
| InChIKey | JYEHFJICKHPKDG-RYUDHWBXSA-N |
| XLogP | 0.82 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|