C12H8BrF2N3O — CID 136906316
2-(2-bromo-3,4-difluorophenyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 136906316) has the molecular formula C12H8BrF2N3O and a molecular weight of 328.12 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136906316 |
| Molecular Formula | C12H8BrF2N3O |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(F)c(F)c2Br)nc2c1CNC2 |
| InChI | InChI=1S/C12H8BrF2N3O/c13-9-5(1-2-7(14)10(9)15)11-17-8-4-16-3-6(8)12(19)18-11/h1-2,16H,3-4H2,(H,17,18,19) |
| InChIKey | LVUIYNJLPCIPED-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|