C13H8BrF2IN2O — CID 136920021
2-(2-bromo-3,4-difluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 136920021) has the molecular formula C13H8BrF2IN2O and a molecular weight of 453.02 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136920021 |
| Molecular Formula | C13H8BrF2IN2O |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 451.88 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccc(F)c(F)c2Br)nc(C2CC2)c1I |
| InChI | InChI=1S/C13H8BrF2IN2O/c14-8-6(3-4-7(15)9(8)16)12-18-11(5-1-2-5)10(17)13(20)19-12/h3-5H,1-2H2,(H,18,19,20) |
| InChIKey | IDYDOQZXZYGRFM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|