C13H9ClFIN2O — CID 137003528
2-(3-chloro-5-fluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 137003528) has the molecular formula C13H9ClFIN2O and a molecular weight of 390.58 g/mol. Its IUPAC name is 2-(3-chloro-5-fluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(3-chloro-5-fluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137003528 |
| Molecular Formula | C13H9ClFIN2O |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 2-(3-chloro-5-fluorophenyl)-4-cyclopropyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2cc(F)cc(Cl)c2)nc(C2CC2)c1I |
| InChI | InChI=1S/C13H9ClFIN2O/c14-8-3-7(4-9(15)5-8)12-17-11(6-1-2-6)10(16)13(19)18-12/h3-6H,1-2H2,(H,17,18,19) |
| InChIKey | MQCFMTKXSIYUFG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|