C13H11Br2IN2OS — CID 136683130
4-cyclopentyl-2-(4,5-dibromothiophen-2-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136683130) has the molecular formula C13H11Br2IN2OS and a molecular weight of 530.02 g/mol. Its IUPAC name is 4-cyclopentyl-2-(4,5-dibromothiophen-2-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopentyl-2-(4,5-dibromothiophen-2-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136683130 |
| Molecular Formula | C13H11Br2IN2OS |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 527.80 |
| IUPAC Name | 4-cyclopentyl-2-(4,5-dibromothiophen-2-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2cc(Br)c(Br)s2)nc(C2CCCC2)c1I |
| InChI | InChI=1S/C13H11Br2IN2OS/c14-7-5-8(20-11(7)15)12-17-10(6-3-1-2-4-6)9(16)13(19)18-12/h5-6H,1-4H2,(H,17,18,19) |
| InChIKey | SFGBKYAEGPAKMJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|