C13H17N5OS — CID 136906558
N'-hydroxy-2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyrimidine-4-carboximidamide (PubChem CID 136906558) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is N'-hydroxy-2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyrimidine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136906558 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N'-hydroxy-2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyrimidine-4-carboximidamide |
| SMILES | CC(C)N(Cc1cccs1)c1nccc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C13H17N5OS/c1-9(2)18(8-10-4-3-7-20-10)13-15-6-5-11(16-13)12(14)17-19/h3-7,9,19H,8H2,1-2H3,(H2,14,17) |
| InChIKey | SKPVTYMUCIENHE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|