C14H14ClN3O4 — CID 136907661
4-chloro-2-[[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]iminomethyl]-6-nitrophenol (PubChem CID 136907661) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is 4-chloro-2-[[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 136907661 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-chloro-2-[[2-hydroxy-2-(1-methylpyrrol-2-yl)ethyl]iminomethyl]-6-nitrophenol |
| SMILES | Cn1cccc1C(O)C/N=C/c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H14ClN3O4/c1-17-4-2-3-11(17)13(19)8-16-7-9-5-10(15)6-12(14(9)20)18(21)22/h2-7,13,19-20H,8H2,1H3/b16-7+ |
| InChIKey | DYPJQVQXQPZPCK-FRKPEAEDSA-N |
| XLogP | 2.44 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|