C17H27N5O2 — CID 136907837
N-cyclohexyl-2-[4-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]acetamide (PubChem CID 136907837) has the molecular formula C17H27N5O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 136907837 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-cyclohexyl-2-[4-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]acetamide |
| SMILES | CC1=CC(=O)NC(=N1)N2CCN(CC2)CC(=O)NC3CCCCC3 |
| InChI | InChI=1S/C17H27N5O2/c1-13-11-15(23)20-17(18-13)22-9-7-21(8-10-22)12-16(24)19-14-5-3-2-4-6-14/h11,14H,2-10,12H2,1H3,(H,19,24)(H,18,20,23) |
| InChIKey | BCNRCOHYSASHCV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | 543 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |