C27H25N7O2 — CID 136909669
(4R)-3-methyl-4-[2-[(3-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136909669) has the molecular formula C27H25N7O2 and a molecular weight of 479.54 g/mol. Its IUPAC name is (4R)-3-methyl-4-[2-[(3-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4R)-3-methyl-4-[2-[(3-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136909669 |
| Molecular Formula | C27H25N7O2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (4R)-3-methyl-4-[2-[(3-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cccc(COc2ccccc2[C@@H]2CC(=O)Nc3c2c(C)nn3-c2ccc3nnc(C)n3n2)c1 |
| InChI | InChI=1S/C27H25N7O2/c1-16-7-6-8-19(13-16)15-36-22-10-5-4-9-20(22)21-14-25(35)28-27-26(21)17(2)31-34(27)24-12-11-23-30-29-18(3)33(23)32-24/h4-13,21H,14-15H2,1-3H3,(H,28,35)/t21-/m0/s1 |
| InChIKey | XRUJFONPPWTFSK-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |