C26H22FN7O2 — CID 136909677
(4R)-4-[2-[(4-fluorophenyl)methoxy]phenyl]-3-methyl-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136909677) has the molecular formula C26H22FN7O2 and a molecular weight of 483.51 g/mol. Its IUPAC name is (4R)-4-[2-[(4-fluorophenyl)methoxy]phenyl]-3-methyl-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4R)-4-[2-[(4-fluorophenyl)methoxy]phenyl]-3-methyl-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136909677 |
| Molecular Formula | C26H22FN7O2 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (4R)-4-[2-[(4-fluorophenyl)methoxy]phenyl]-3-methyl-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn(-c2ccc3nnc(C)n3n2)c2c1[C@H](c1ccccc1OCc1ccc(F)cc1)CC(=O)N2 |
| InChI | InChI=1S/C26H22FN7O2/c1-15-25-20(19-5-3-4-6-21(19)36-14-17-7-9-18(27)10-8-17)13-24(35)28-26(25)34(31-15)23-12-11-22-30-29-16(2)33(22)32-23/h3-12,20H,13-14H2,1-2H3,(H,28,35)/t20-/m0/s1 |
| InChIKey | WRGIURBDQIRSFD-FQEVSTJZSA-N |
| XLogP | 4.12 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |