C26H23N7O2 — CID 136758311
(4S)-4-[2-[(2-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136758311) has the molecular formula C26H23N7O2 and a molecular weight of 465.52 g/mol. Its IUPAC name is (4S)-4-[2-[(2-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-[2-[(2-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136758311 |
| Molecular Formula | C26H23N7O2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (4S)-4-[2-[(2-methylphenyl)methoxy]phenyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1ccccc1COc1ccccc1[C@H]1CC(=O)Nc2c1cnn2-c1ccc2nnc(C)n2n1 |
| InChI | InChI=1S/C26H23N7O2/c1-16-7-3-4-8-18(16)15-35-22-10-6-5-9-19(22)20-13-25(34)28-26-21(20)14-27-33(26)24-12-11-23-30-29-17(2)32(23)31-24/h3-12,14,20H,13,15H2,1-2H3,(H,28,34)/t20-/m1/s1 |
| InChIKey | VEOLXQKDPTUNAR-HXUWFJFHSA-N |
| XLogP | 3.98 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |