C20H19N7O4 — CID 136792892
(4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136792892) has the molecular formula C20H19N7O4 and a molecular weight of 421.42 g/mol. Its IUPAC name is (4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136792892 |
| Molecular Formula | C20H19N7O4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | COc1cc([C@H]2CC(=O)Nc3c2cnn3-c2ccc3nnc(C)n3n2)cc(OC)c1O |
| InChI | InChI=1S/C20H19N7O4/c1-10-23-24-16-4-5-17(25-26(10)16)27-20-13(9-21-27)12(8-18(28)22-20)11-6-14(30-2)19(29)15(7-11)31-3/h4-7,9,12,29H,8H2,1-3H3,(H,22,28)/t12-/m1/s1 |
| InChIKey | XJQMKRDDHMJVML-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |