C27H25N7O3 — CID 136758356
(4S)-4-(3-ethoxy-4-phenylmethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136758356) has the molecular formula C27H25N7O3 and a molecular weight of 495.54 g/mol. Its IUPAC name is (4S)-4-(3-ethoxy-4-phenylmethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-(3-ethoxy-4-phenylmethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136758356 |
| Molecular Formula | C27H25N7O3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (4S)-4-(3-ethoxy-4-phenylmethoxyphenyl)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CCOc1cc([C@@H]2CC(=O)Nc3c2cnn3-c2ccc3nnc(C)n3n2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H25N7O3/c1-3-36-23-13-19(9-10-22(23)37-16-18-7-5-4-6-8-18)20-14-26(35)29-27-21(20)15-28-34(27)25-12-11-24-31-30-17(2)33(24)32-25/h4-13,15,20H,3,14,16H2,1-2H3,(H,29,35)/t20-/m0/s1 |
| InChIKey | VSGFDSMZFUOJLO-FQEVSTJZSA-N |
| XLogP | 4.07 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |