C15H14BrN3O3S — CID 136909984
(5R)-5-(5-bromo-2-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136909984) has the molecular formula C15H14BrN3O3S and a molecular weight of 396.27 g/mol. Its IUPAC name is (5R)-5-(5-bromo-2-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5R)-5-(5-bromo-2-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136909984 |
| Molecular Formula | C15H14BrN3O3S |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | (5R)-5-(5-bromo-2-methoxyphenyl)-2-methylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | COc1ccc(Br)cc1[C@H]1CC(=O)Nc2nc(SC)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H14BrN3O3S/c1-22-10-4-3-7(16)5-8(10)9-6-11(20)17-13-12(9)14(21)19-15(18-13)23-2/h3-5,9H,6H2,1-2H3,(H2,17,18,19,20,21)/t9-/m1/s1 |
| InChIKey | KLWSLSFZPTYZPH-SECBINFHSA-N |
| XLogP | 2.74 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |