C16H16BrN3O3S — CID 136909985
(5S)-5-(5-bromo-2-methoxyphenyl)-2-ethylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136909985) has the molecular formula C16H16BrN3O3S and a molecular weight of 410.29 g/mol. Its IUPAC name is (5S)-5-(5-bromo-2-methoxyphenyl)-2-ethylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-5-(5-bromo-2-methoxyphenyl)-2-ethylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136909985 |
| Molecular Formula | C16H16BrN3O3S |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | (5S)-5-(5-bromo-2-methoxyphenyl)-2-ethylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCSc1nc2c(c(=O)[nH]1)[C@H](c1cc(Br)ccc1OC)CC(=O)N2 |
| InChI | InChI=1S/C16H16BrN3O3S/c1-3-24-16-19-14-13(15(22)20-16)10(7-12(21)18-14)9-6-8(17)4-5-11(9)23-2/h4-6,10H,3,7H2,1-2H3,(H2,18,19,20,21,22)/t10-/m0/s1 |
| InChIKey | IJLDQMHBDUNNLB-JTQLQIEISA-N |
| XLogP | 3.13 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |