C11H14ClN3O2 — CID 136910421
2-(chloromethyl)-4-[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136910421) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is 2-(chloromethyl)-4-[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-(chloromethyl)-4-[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136910421 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-(chloromethyl)-4-[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | CCN1C[C@@H](c2cc(=O)[nH]c(CCl)n2)CC1=O |
| InChI | InChI=1S/C11H14ClN3O2/c1-2-15-6-7(3-11(15)17)8-4-10(16)14-9(5-12)13-8/h4,7H,2-3,5-6H2,1H3,(H,13,14,16)/t7-/m0/s1 |
| InChIKey | ZKCFXUJGCZYMLD-ZETCQYMHSA-N |
| XLogP | 0.84 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|