C18H17N3O6 — CID 136911335
(3S)-N-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 136911335) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is (3S)-N-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 136911335 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3S)-N-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(CNC(=O)[C@@H]1COc2ccccc2O1)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C18H17N3O6/c22-12-6-5-11(13(23)7-12)8-20-21-17(24)9-19-18(25)16-10-26-14-3-1-2-4-15(14)27-16/h1-8,16,22-23H,9-10H2,(H,19,25)(H,21,24)/b20-8-/t16-/m0/s1 |
| InChIKey | YPJXIHQWOKEBEG-AAOXPJKVSA-N |
| XLogP | 0.50 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|