C18H15Cl2N3O4 — CID 46859010
N-[2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 46859010) has the molecular formula C18H15Cl2N3O4 and a molecular weight of 408.24 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 46859010 |
| Molecular Formula | C18H15Cl2N3O4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-[2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(CNC(=O)C1COc2ccccc2O1)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O4/c19-12-6-5-11(13(20)7-12)8-22-23-17(24)9-21-18(25)16-10-26-14-3-1-2-4-15(14)27-16/h1-8,16H,9-10H2,(H,21,25)(H,23,24)/b22-8+ |
| InChIKey | SOGORDJSGOFIBT-GZIVZEMBSA-N |
| XLogP | 2.40 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|