C22H22N4O3 — CID 136911340
(E)-3-(2-methoxyphenyl)-N-[2-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide (PubChem CID 136911340) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-[2-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-[2-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 136911340 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-[2-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NCC(=O)N/N=C\c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H22N4O3/c1-15-18(17-8-4-5-9-19(17)25-15)13-24-26-22(28)14-23-21(27)12-11-16-7-3-6-10-20(16)29-2/h3-13,25H,14H2,1-2H3,(H,23,27)(H,26,28)/b12-11+,24-13- |
| InChIKey | OXODQTLINVYBOZ-JPWPGHPXSA-N |
| XLogP | 2.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|