C9H13ClN4O2 — CID 136914197
3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]-N-methylpropanamide (PubChem CID 136914197) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]-N-methylpropanamide.
| Compound Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 136914197 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C9H13ClN4O2/c1-11-6(15)3-4-14(2)8-7(10)9(16)13-5-12-8/h5H,3-4H2,1-2H3,(H,11,15)(H,12,13,16) |
| InChIKey | UEQZNXACTMXKLL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |