C12H6FN3O3S — CID 136914259
6-(4-fluoro-2-nitrophenyl)-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136914259) has the molecular formula C12H6FN3O3S and a molecular weight of 291.26 g/mol. Its IUPAC name is 6-(4-fluoro-2-nitrophenyl)-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(4-fluoro-2-nitrophenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136914259 |
| Molecular Formula | C12H6FN3O3S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 6-(4-fluoro-2-nitrophenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2cc(-c3ccc(F)cc3[N+](=O)[O-])sc12 |
| InChI | InChI=1S/C12H6FN3O3S/c13-6-1-2-7(9(3-6)16(18)19)10-4-8-11(20-10)12(17)15-5-14-8/h1-5H,(H,14,15,17) |
| InChIKey | CIMLNZISZMAMRO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|