About 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide
4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide (PubChem CID 140675008) has the molecular formula C7H5N3O2S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide |
| PubChem CID | 140675008 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide |
| SMILES | NC(=O)c1cc2nc[nH]c(=O)c2s1 |
| InChI | InChI=1S/C7H5N3O2S/c8-6(11)4-1-3-5(13-4)7(12)10-2-9-3/h1-2H,(H2,8,11)(H,9,10,12) |
| InChIKey | AAFIHWBLUZWBFO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide?
The IUPAC name of 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide (CID 140675008) is 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide.
What is the SMILES notation for 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide?
The canonical SMILES for 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide is NC(=O)c1cc2nc[nH]c(=O)c2s1.
What is the InChIKey of 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide?
The InChIKey is AAFIHWBLUZWBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2S/c8-6(11)4-1-3-5(13-4)7(12)10-2-9-3/h1-2H,(H2,8,11)(H,9,10,12).
What are the key properties of 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide?
4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide has a molecular weight of 195.20 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3H-thieno[3,2-d]pyrimidine-6-carboxamide is sourced from PubChem (CID 140675008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).