About N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine
N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine (PubChem CID 136914414) has the molecular formula C20H20N4
and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine.
Molecular Properties
| Compound Name | N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine |
| PubChem CID | 136914414 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine |
| SMILES | CCn1c(N=Cc2c[nH]c3ccccc23)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H20N4/c1-4-24-19-10-14(3)13(2)9-18(19)23-20(24)22-12-15-11-21-17-8-6-5-7-16(15)17/h5-12,21H,4H2,1-3H3 |
| InChIKey | LBFDBPMXRUAHAK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine?
The IUPAC name of N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine (CID 136914414) is N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine.
What is the SMILES notation for N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine?
The canonical SMILES for N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine is CCn1c(N=Cc2c[nH]c3ccccc23)nc2cc(C)c(C)cc21.
What is the InChIKey of N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine?
The InChIKey is LBFDBPMXRUAHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4/c1-4-24-19-10-14(3)13(2)9-18(19)23-20(24)22-12-15-11-21-17-8-6-5-7-16(15)17/h5-12,21H,4H2,1-3H3.
What are the key properties of N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine?
N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine has a molecular weight of 316.41 g/mol, XLogP of 4.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethyl-5,6-dimethylbenzimidazol-2-yl)-1-(1H-indol-3-yl)methanimine is sourced from PubChem (CID 136914414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).