C23H22N2O4S — CID 136915201
(2S)-1-[(3S)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-methoxy-2-phenylethanone (PubChem CID 136915201) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is (2S)-1-[(3S)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-methoxy-2-phenylethanone.
| Compound Name | (2S)-1-[(3S)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-methoxy-2-phenylethanone |
|---|---|
| PubChem CID | 136915201 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (2S)-1-[(3S)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-methoxy-2-phenylethanone |
| SMILES | COc1cc(C2=NN(C(=O)[C@@H](OC)c3ccccc3)[C@H](c3cccs3)C2)ccc1O |
| InChI | InChI=1S/C23H22N2O4S/c1-28-20-13-16(10-11-19(20)26)17-14-18(21-9-6-12-30-21)25(24-17)23(27)22(29-2)15-7-4-3-5-8-15/h3-13,18,22,26H,14H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | XNFQKMJGCXDQLX-AVRDEDQJSA-N |
| XLogP | 4.53 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|