C19H16N2O4S — CID 136915182
furan-2-yl-[(3R)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 136915182) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is furan-2-yl-[(3R)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | furan-2-yl-[(3R)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 136915182 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | furan-2-yl-[(3R)-5-(4-hydroxy-3-methoxyphenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | COc1cc(C2=NN(C(=O)c3ccco3)[C@@H](c3cccs3)C2)ccc1O |
| InChI | InChI=1S/C19H16N2O4S/c1-24-17-10-12(6-7-15(17)22)13-11-14(18-5-3-9-26-18)21(20-13)19(23)16-4-2-8-25-16/h2-10,14,22H,11H2,1H3/t14-/m1/s1 |
| InChIKey | RFUUXLKFJRESAL-CQSZACIVSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|