C20H15FN2O3 — CID 97310305
[(3S)-5-(3-fluorophenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone (PubChem CID 97310305) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is [(3S)-5-(3-fluorophenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone.
| Compound Name | [(3S)-5-(3-fluorophenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97310305 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(3S)-5-(3-fluorophenyl)-3-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1N=C(c2cccc(F)c2)C[C@H]1c1ccccc1O |
| InChI | InChI=1S/C20H15FN2O3/c21-14-6-3-5-13(11-14)16-12-17(15-7-1-2-8-18(15)24)23(22-16)20(25)19-9-4-10-26-19/h1-11,17,24H,12H2/t17-/m0/s1 |
| InChIKey | HKWDGVKGEILICS-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|