C19H16N2O5 — CID 41105781
furan-2-yl-[(3R)-5-(furan-2-yl)-3-(2-hydroxy-3-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 41105781) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is furan-2-yl-[(3R)-5-(furan-2-yl)-3-(2-hydroxy-3-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | furan-2-yl-[(3R)-5-(furan-2-yl)-3-(2-hydroxy-3-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 41105781 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | furan-2-yl-[(3R)-5-(furan-2-yl)-3-(2-hydroxy-3-methoxyphenyl)-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | COc1cccc([C@H]2CC(c3ccco3)=NN2C(=O)c2ccco2)c1O |
| InChI | InChI=1S/C19H16N2O5/c1-24-16-6-2-5-12(18(16)22)14-11-13(15-7-3-9-25-15)20-21(14)19(23)17-8-4-10-26-17/h2-10,14,22H,11H2,1H3/t14-/m1/s1 |
| InChIKey | IZAJMTXMIDUPHN-CQSZACIVSA-N |
| XLogP | 3.58 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|