C22H16ClN3O3 — CID 4589845
[3-(2-chloro-8-methylquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone (PubChem CID 4589845) has the molecular formula C22H16ClN3O3 and a molecular weight of 405.84 g/mol. Its IUPAC name is [3-(2-chloro-8-methylquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone.
| Compound Name | [3-(2-chloro-8-methylquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 4589845 |
| Molecular Formula | C22H16ClN3O3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [3-(2-chloro-8-methylquinolin-3-yl)-5-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-(furan-2-yl)methanone |
| SMILES | Cc1cccc2cc(C3CC(c4ccco4)=NN3C(=O)c3ccco3)c(Cl)nc12 |
| InChI | InChI=1S/C22H16ClN3O3/c1-13-5-2-6-14-11-15(21(23)24-20(13)14)17-12-16(18-7-3-9-28-18)25-26(17)22(27)19-8-4-10-29-19/h2-11,17H,12H2,1H3 |
| InChIKey | XMWUUFDVCXZUJF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|