C18H14N2O3S — CID 97079923
furan-2-yl-[(3R)-3-(2-hydroxyphenyl)-5-thiophen-3-yl-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 97079923) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is furan-2-yl-[(3R)-3-(2-hydroxyphenyl)-5-thiophen-3-yl-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | furan-2-yl-[(3R)-3-(2-hydroxyphenyl)-5-thiophen-3-yl-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 97079923 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | furan-2-yl-[(3R)-3-(2-hydroxyphenyl)-5-thiophen-3-yl-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | O=C(c1ccco1)N1N=C(c2ccsc2)C[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C18H14N2O3S/c21-16-5-2-1-4-13(16)15-10-14(12-7-9-24-11-12)19-20(15)18(22)17-6-3-8-23-17/h1-9,11,15,21H,10H2/t15-/m1/s1 |
| InChIKey | CEHVBMAWLKTEPK-OAHLLOKOSA-N |
| XLogP | 4.04 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|