C18H14N2OS2 — CID 97080916
[(3S)-3,5-di(thiophen-3-yl)-3,4-dihydropyrazol-2-yl]-phenylmethanone (PubChem CID 97080916) has the molecular formula C18H14N2OS2 and a molecular weight of 338.46 g/mol. Its IUPAC name is [(3S)-3,5-di(thiophen-3-yl)-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | [(3S)-3,5-di(thiophen-3-yl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 97080916 |
| Molecular Formula | C18H14N2OS2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(3S)-3,5-di(thiophen-3-yl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1N=C(c2ccsc2)C[C@H]1c1ccsc1 |
| InChI | InChI=1S/C18H14N2OS2/c21-18(13-4-2-1-3-5-13)20-17(15-7-9-23-12-15)10-16(19-20)14-6-8-22-11-14/h1-9,11-12,17H,10H2/t17-/m0/s1 |
| InChIKey | YFKBHJQCOUIQLN-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |