C23H34N4O3 — CID 136916298
1-benzyl-5-[N-[(2R)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 136916298) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-benzyl-5-[N-[(2R)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-benzyl-5-[N-[(2R)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136916298 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 1-benzyl-5-[N-[(2R)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CC/C(=N\[C@H](C)CCCN(CC)CC)c1c(O)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H34N4O3/c1-5-19(24-17(4)12-11-15-26(6-2)7-3)20-21(28)25-23(30)27(22(20)29)16-18-13-9-8-10-14-18/h8-10,13-14,17,29H,5-7,11-12,15-16H2,1-4H3,(H,25,28,30)/b24-19+/t17-/m1/s1 |
| InChIKey | HHUXPOTYRNHAJC-BXBKDCBCSA-N |
| XLogP | 3.00 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|