C24H20N6O4 — CID 136917099
(4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136917099) has the molecular formula C24H20N6O4 and a molecular weight of 456.46 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136917099 |
| Molecular Formula | C24H20N6O4 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | COc1cccc(-c2cnnc(-n3nc(C)c4c3NC(=O)C[C@H]4c3ccc4c(c3)OCO4)n2)c1 |
| InChI | InChI=1S/C24H20N6O4/c1-13-22-17(14-6-7-19-20(9-14)34-12-33-19)10-21(31)27-23(22)30(29-13)24-26-18(11-25-28-24)15-4-3-5-16(8-15)32-2/h3-9,11,17H,10,12H2,1-2H3,(H,27,31)/t17-/m0/s1 |
| InChIKey | FITWYIMPUOKKOL-KRWDZBQOSA-N |
| XLogP | 3.24 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |